CAS 1554-05-8 is the registry number for 2-Bromo-2'-fluoro-1,1'-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
1-bromo-2-(2-fluorophenyl)benzene (CAS 1554-05-8) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 1-bromo-2-(2-fluorophenyl)benzene. InChIKey: YNNKKNMFSBLUQN-UHFFFAOYSA-N.
| Molecular formula | C12H8BrF |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 1-bromo-2-(2-fluorophenyl)benzene |
| InChIKey | YNNKKNMFSBLUQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2Br)F |
Computed by PubChem (NCBI)