Products 1554-05-8

CAS 1554-05-8 is the registry number for 2-Bromo-2'-fluoro-1,1'-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-bromo-2-(2-fluorophenyl)benzene (CAS 1554-05-8) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 1-bromo-2-(2-fluorophenyl)benzene. InChIKey: YNNKKNMFSBLUQN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8BrF
Molecular weight251.09 g/mol
IUPAC name1-bromo-2-(2-fluorophenyl)benzene
InChIKeyYNNKKNMFSBLUQN-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC=CC=C2Br)F

Computed by PubChem (NCBI)