Products 398-21-0
CAS 398-21-0 appears in our catalog under these names: 4–Bromo–4'–fluorobiphenyl, 4-BROMO-4'-FLUOROBIPHENYL, 97%, 4-Bromo-4'-fluorobiphenyl, 95%, 4-Bromo-4'-fluoro-1,1'-biphenyl, 95%. Offered by: GLPBio, Sigma-Aldrich, Fluorochem, Ambeed. Available pack sizes: 1g, 500MG, 250mg, 5g, 100mg, 25g.
1-bromo-4-(4-fluorophenyl)benzene (CAS 398-21-0) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 1-bromo-4-(4-fluorophenyl)benzene. InChIKey: XFGPSHWWPIFPNL-UHFFFAOYSA-N.
| Molecular formula | C12H8BrF |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 1-bromo-4-(4-fluorophenyl)benzene |
| InChIKey | XFGPSHWWPIFPNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)
Synonyms:
4-Bromo-4'-fluoro-1,1'-biphenyl, 1-bromo-4-(4-fluorophenyl)benzene, 1,1'-Biphenyl, 4-bromo-4'-fluoro-, Biphenyl, 4-bromo-4'-fluoro-, 4-Bromo-4'-fluorobiphenyl, 4'-fluoro-4-bromobiphenyl, 4-fluoro-4'-bromobiphenyl, 4'-bromo-4-fluoro-biphenyl, 4'-fluoro-4-bromo-biphenyl, 4-bromo-4'-fluoro-biphenyl