CAS 398-21-0 appears in our catalog under these names: 4–Bromo–4'–fluorobiphenyl, 4-Bromo-4'-fluoro-1,1'-biphenyl 95%, 4-BROMO-4'-FLUOROBIPHENYL, 97%, 4-Bromo-4'-fluorobiphenyl, 95%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 500MG.
1-bromo-4-(4-fluorophenyl)benzene (CAS 398-21-0) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 1-bromo-4-(4-fluorophenyl)benzene. InChIKey: XFGPSHWWPIFPNL-UHFFFAOYSA-N.
| Molecular formula | C12H8BrF |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 1-bromo-4-(4-fluorophenyl)benzene |
| InChIKey | XFGPSHWWPIFPNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)