CAS 1809168-63-5 is the registry number for 5-Bromo-2-fluorobiphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-bromo-1-fluoro-2-phenylbenzene (CAS 1809168-63-5) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 4-bromo-1-fluoro-2-phenylbenzene. InChIKey: BQAIYMUEKIDCRB-UHFFFAOYSA-N.
| Molecular formula | C12H8BrF |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 4-bromo-1-fluoro-2-phenylbenzene |
| InChIKey | BQAIYMUEKIDCRB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)