CAS 89346-54-3 is the registry number for 2-Bromo-4'-fluoro-1,1'-biphenyl, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-bromo-2-(4-fluorophenyl)benzene (CAS 89346-54-3) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 1-bromo-2-(4-fluorophenyl)benzene. InChIKey: RYODPXPHDPGULP-UHFFFAOYSA-N.
| Molecular formula | C12H8BrF |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 1-bromo-2-(4-fluorophenyl)benzene |
| InChIKey | RYODPXPHDPGULP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)F)Br |
Computed by PubChem (NCBI)