CAS 1516081-14-3 appears in our catalog under these names: 2-(3-Bromo-2,6-difluorophenyl)acetonitrile, 2-(3-Bromo-2,6-difluorophenyl)acetonitrile, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 250mg, 2,5g, 1g, 5g.
2-(3-bromo-2,6-difluorophenyl)acetonitrile (CAS 1516081-14-3) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 2-(3-bromo-2,6-difluorophenyl)acetonitrile. InChIKey: IWAMIZNQNATIKJ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 2-(3-bromo-2,6-difluorophenyl)acetonitrile |
| InChIKey | IWAMIZNQNATIKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)CC#N)F)Br |
Computed by PubChem (NCBI)