Products 1519204-68-2
CAS 1519204-68-2 is the registry number for 2-Chloro-1-(5-(propan-2-yloxy)-1H-indol-3-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-1-(5-propan-2-yloxy-1H-indol-3-yl)ethanone (CAS 1519204-68-2) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: 2-chloro-1-(5-propan-2-yloxy-1H-indol-3-yl)ethanone. InChIKey: OJJJMLWLJKTIBR-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 2-chloro-1-(5-propan-2-yloxy-1H-indol-3-yl)ethanone |
| InChIKey | OJJJMLWLJKTIBR-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C1)NC=C2C(=O)CCl |
Computed by PubChem (NCBI)