CAS 151985-18-1 is the registry number for 6-Bromo-3,3-dimethyl-1,3-dihydro-2-benzofuran-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-bromo-3,3-dimethyl-2-benzofuran-1-one (CAS 151985-18-1) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-2-benzofuran-1-one. InChIKey: OIAQBIFAALGMAC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-2-benzofuran-1-one |
| InChIKey | OIAQBIFAALGMAC-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Br)C(=O)O1)C |
Computed by PubChem (NCBI)