CAS 152612-26-5 appears in our catalog under these names: D-3-Thienylalanine, 95%, (R)-2-Amino-3-(thiophen-3-yl)propanoic acid hydrochloride, 95+%, (R)-2-Amino-3-(thiophen-3-yl)propanoic acid hydrochloride, 95%, 95%, (R)-2-Amino-3-(thiophen-3-yl)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2R)-2-amino-3-thiophen-3-ylpropanoic acid;hydrochloride (CAS 152612-26-5) is a chemical compound with the molecular formula C7H10ClNO2S and a molecular weight of 207.68 g/mol. IUPAC name: (2R)-2-amino-3-thiophen-3-ylpropanoic acid;hydrochloride. InChIKey: VWVKLOOCZNQENR-FYZOBXCZSA-N.
| Molecular formula | C7H10ClNO2S |
|---|---|
| Molecular weight | 207.68 g/mol |
| IUPAC name | (2R)-2-amino-3-thiophen-3-ylpropanoic acid;hydrochloride |
| InChIKey | VWVKLOOCZNQENR-FYZOBXCZSA-N |
| SMILES | C1=CSC=C1C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)