CAS 80213-28-1 appears in our catalog under these names: 3-(Methylsulfonyl)aniline hydrochloride, 96%, 3-(Methylsulfonyl)aniline hydrochloride, 98%, 3-Methylsulphonylaniline hydrochloride, 95%, 3-(Methylsulfonyl)aniline hydrochloride, 97%, 97%, 3-(Methylsulfonyl)aniline hydrochloride, 95%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 2.5g, 100mg, 250mg.
3-methylsulfonylaniline;hydrochloride (CAS 80213-28-1) is a chemical compound with the molecular formula C7H10ClNO2S and a molecular weight of 207.68 g/mol. IUPAC name: 3-methylsulfonylaniline;hydrochloride. InChIKey: ZMPXGSYLKFAGOV-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO2S |
|---|---|
| Molecular weight | 207.68 g/mol |
| IUPAC name | 3-methylsulfonylaniline;hydrochloride |
| InChIKey | ZMPXGSYLKFAGOV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)N.Cl |
Computed by PubChem (NCBI)