Products 2093851-37-5
CAS 2093851-37-5 appears in our catalog under these names: 2-(Dimethyl-1,3-thiazol-5-yl)acetic acid hydrochloride, 95%, 2-(Dimethyl-1,3-thiazol-5-yl)acetic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g.
2-(2,4-dimethyl-1,3-thiazol-5-yl)acetic acid;hydrochloride (CAS 2093851-37-5) is a chemical compound with the molecular formula C7H10ClNO2S and a molecular weight of 207.68 g/mol. IUPAC name: 2-(2,4-dimethyl-1,3-thiazol-5-yl)acetic acid;hydrochloride. InChIKey: NHFBHPLBDMYKOO-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO2S |
|---|---|
| Molecular weight | 207.68 g/mol |
| IUPAC name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)acetic acid;hydrochloride |
| InChIKey | NHFBHPLBDMYKOO-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)CC(=O)O.Cl |
Computed by PubChem (NCBI)