Products 2248257-87-4

CAS 2248257-87-4 is the registry number for 2-Amino-3-(thiophen-3-yl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

2-amino-3-thiophen-3-ylpropanoic acid;hydrochloride (CAS 2248257-87-4) is a chemical compound with the molecular formula C7H10ClNO2S and a molecular weight of 207.68 g/mol. IUPAC name: 2-amino-3-thiophen-3-ylpropanoic acid;hydrochloride. InChIKey: VWVKLOOCZNQENR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10ClNO2S
Molecular weight207.68 g/mol
IUPAC name2-amino-3-thiophen-3-ylpropanoic acid;hydrochloride
InChIKeyVWVKLOOCZNQENR-UHFFFAOYSA-N
SMILESC1=CSC=C1CC(C(=O)O)N.Cl

Computed by PubChem (NCBI)