CAS 547762-42-5 appears in our catalog under these names: Methyl 5-amino-3-methylthiophene-2-carboxylate hydrochloride, 95%, Methyl 5-amino-3-methylthiophene-2-carboxylate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
Methyl 5-amino-3-methylthiophene-2-carboxylate;hydrochloride (CAS 547762-42-5) is a chemical compound with the molecular formula C7H10ClNO2S and a molecular weight of 207.68 g/mol. IUPAC name: methyl 5-amino-3-methylthiophene-2-carboxylate;hydrochloride. InChIKey: GPQQLDMFYXCXOT-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO2S |
|---|---|
| Molecular weight | 207.68 g/mol |
| IUPAC name | methyl 5-amino-3-methylthiophene-2-carboxylate;hydrochloride |
| InChIKey | GPQQLDMFYXCXOT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)