CAS 177662-76-9 appears in our catalog under these names: 4-(Methylsulfonyl)aniline hydrochloride, 98%, 4-(Methylsulfonyl)aniline hydrochloride, 99%(HPLC),RG, 99%(HPLC),RG, 4-(Methylsulfonyl)aniline hydrochloride, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 250mg.
4-methylsulfonylaniline;hydrochloride (CAS 177662-76-9) is a chemical compound with the molecular formula C7H10ClNO2S and a molecular weight of 207.68 g/mol. IUPAC name: 4-methylsulfonylaniline;hydrochloride. InChIKey: NMEAGYKSZYLEAS-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO2S |
|---|---|
| Molecular weight | 207.68 g/mol |
| IUPAC name | 4-methylsulfonylaniline;hydrochloride |
| InChIKey | NMEAGYKSZYLEAS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)