Products 893741-48-5

CAS 893741-48-5 is the registry number for 5-[(Methylamino)methyl]thiophene-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-(methylaminomethyl)thiophene-2-carboxylic acid;hydrochloride (CAS 893741-48-5) is a chemical compound with the molecular formula C7H10ClNO2S and a molecular weight of 207.68 g/mol. IUPAC name: 5-(methylaminomethyl)thiophene-2-carboxylic acid;hydrochloride. InChIKey: FEDZRZXMJAQOPA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10ClNO2S
Molecular weight207.68 g/mol
IUPAC name5-(methylaminomethyl)thiophene-2-carboxylic acid;hydrochloride
InChIKeyFEDZRZXMJAQOPA-UHFFFAOYSA-N
SMILESCNCC1=CC=C(S1)C(=O)O.Cl

Computed by PubChem (NCBI)