CAS 2172600-93-8 appears in our catalog under these names: 4-(aminomethyl)-5-methylthiophene-2-carboxylic acid hydrochloride, 95%, 4-(Aminomethyl)-5-methylthiophene-2-carboxylic acid hydrochloride, 98%, 4-(Aminomethyl)-5-methylthiophene-2-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g.
4-(aminomethyl)-5-methylthiophene-2-carboxylic acid;hydrochloride (CAS 2172600-93-8) is a chemical compound with the molecular formula C7H10ClNO2S and a molecular weight of 207.68 g/mol. IUPAC name: 4-(aminomethyl)-5-methylthiophene-2-carboxylic acid;hydrochloride. InChIKey: VFDURYDWXWRPEQ-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO2S |
|---|---|
| Molecular weight | 207.68 g/mol |
| IUPAC name | 4-(aminomethyl)-5-methylthiophene-2-carboxylic acid;hydrochloride |
| InChIKey | VFDURYDWXWRPEQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(S1)C(=O)O)CN.Cl |
Computed by PubChem (NCBI)