Products 153203-57-7
CAS 153203-57-7 appears in our catalog under these names: 3-Chloro-5-(methoxycarbonyl)benzoic acid, 97%, 97%, 3-Chloro-5-(methoxycarbonyl)benzoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-5-methoxycarbonylbenzoic acid (CAS 153203-57-7) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 3-chloro-5-methoxycarbonylbenzoic acid. InChIKey: HLARAVKGVUMKCY-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 3-chloro-5-methoxycarbonylbenzoic acid |
| InChIKey | HLARAVKGVUMKCY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)