CAS 153877-54-4 is the registry number for (2,5-difluorophenyl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2,5-difluorophenyl)-phenylmethanol (CAS 153877-54-4) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: (2,5-difluorophenyl)-phenylmethanol. InChIKey: UHEPZSBCKFLCCO-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | (2,5-difluorophenyl)-phenylmethanol |
| InChIKey | UHEPZSBCKFLCCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C=CC(=C2)F)F)O |
Computed by PubChem (NCBI)