CAS 1543266-12-1 is the registry number for 5-(4-fluorobenzyl)-1H-1,2,4-triazole-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxylic acid (CAS 1543266-12-1) is a chemical compound with the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. IUPAC name: 5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxylic acid. InChIKey: XBSDLNOKSVHARL-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O2 |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxylic acid |
| InChIKey | XBSDLNOKSVHARL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NC(=NN2)C(=O)O)F |
Computed by PubChem (NCBI)