Products 154869-12-2
CAS 154869-12-2 is the registry number for N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-(N-hydroxyimino)acetamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyiminoacetamide (CAS 154869-12-2) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: (2E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyiminoacetamide. InChIKey: RYGNABOONRGSDG-IZZDOVSWSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | (2E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyiminoacetamide |
| InChIKey | RYGNABOONRGSDG-IZZDOVSWSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)NC(=O)/C=N/O |
Computed by PubChem (NCBI)