CAS 1549597-57-0 appears in our catalog under these names: 2-Bromo-1-fluoro-4-(2,2,2-trifluoroethoxy)benzene, 95%, 2-Bromo-1-fluoro-4-(2,2,2-trifluoroethoxy)benzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-bromo-1-fluoro-4-(2,2,2-trifluoroethoxy)benzene (CAS 1549597-57-0) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 2-bromo-1-fluoro-4-(2,2,2-trifluoroethoxy)benzene. InChIKey: NEKCXSBTWPBPLM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 2-bromo-1-fluoro-4-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | NEKCXSBTWPBPLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)Br)F |
Computed by PubChem (NCBI)