Products 1550761-12-0
CAS 1550761-12-0 is the registry number for 3-Oxo-2,3-dihydrobenzo[d]isoxazole-7-carboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-oxo-1,2-benzoxazole-7-carboxylic acid (CAS 1550761-12-0) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 3-oxo-1,2-benzoxazole-7-carboxylic acid. InChIKey: VYWDDMBTKCWCKX-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 3-oxo-1,2-benzoxazole-7-carboxylic acid |
| InChIKey | VYWDDMBTKCWCKX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)ONC2=O |
Computed by PubChem (NCBI)