CAS 155382-86-8 appears in our catalog under these names: 3,4–Dichloro–2–methoxybenzoic acid, 3,4-Dichloro-2-methoxybenzoic acid 95%, 3,4-Dichloro-2-methoxybenzoic acid, 95%, 95%, 3,4-Dichloro-2-methoxybenzoic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
3,4-dichloro-2-methoxybenzoic acid (CAS 155382-86-8) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 3,4-dichloro-2-methoxybenzoic acid. InChIKey: VSFXUMIYSSTHSQ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 3,4-dichloro-2-methoxybenzoic acid |
| InChIKey | VSFXUMIYSSTHSQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)