Products 1555998-02-1

CAS 1555998-02-1 is the registry number for 2-Oxo-2,3-dihydrooxazolo[4,5-b]pyridine-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-oxo-3H-[1,3]oxazolo[4,5-b]pyridine-6-carboxylic acid (CAS 1555998-02-1) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 2-oxo-3H-[1,3]oxazolo[4,5-b]pyridine-6-carboxylic acid. InChIKey: HZZYDCLFSMKYNL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4N2O4
Molecular weight180.12 g/mol
IUPAC name2-oxo-3H-[1,3]oxazolo[4,5-b]pyridine-6-carboxylic acid
InChIKeyHZZYDCLFSMKYNL-UHFFFAOYSA-N
SMILESC1=C(C=NC2=C1OC(=O)N2)C(=O)O

Computed by PubChem (NCBI)