CAS 1555998-02-1 is the registry number for 2-Oxo-2,3-dihydrooxazolo[4,5-b]pyridine-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxo-3H-[1,3]oxazolo[4,5-b]pyridine-6-carboxylic acid (CAS 1555998-02-1) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 2-oxo-3H-[1,3]oxazolo[4,5-b]pyridine-6-carboxylic acid. InChIKey: HZZYDCLFSMKYNL-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 2-oxo-3H-[1,3]oxazolo[4,5-b]pyridine-6-carboxylic acid |
| InChIKey | HZZYDCLFSMKYNL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1OC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)