CAS 2092501-37-4 is the registry number for 5-Nitrobenzo[d]isoxazol-6-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-nitro-1,2-benzoxazol-6-ol (CAS 2092501-37-4) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 5-nitro-1,2-benzoxazol-6-ol. InChIKey: GGGKBWDKWWSCSY-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 5-nitro-1,2-benzoxazol-6-ol |
| InChIKey | GGGKBWDKWWSCSY-UHFFFAOYSA-N |
| SMILES | C1=C2C=NOC2=CC(=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)