CAS 1823916-79-5 is the registry number for 3-Nitrofuro[3,4-b]pyridin-5(7H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-nitro-7H-furo[3,4-b]pyridin-5-one (CAS 1823916-79-5) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 3-nitro-7H-furo[3,4-b]pyridin-5-one. InChIKey: CNFNLERXFJHMCO-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 3-nitro-7H-furo[3,4-b]pyridin-5-one |
| InChIKey | CNFNLERXFJHMCO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=N2)[N+](=O)[O-])C(=O)O1 |
Computed by PubChem (NCBI)