CAS 36238-81-0 is the registry number for 6-Nitro-2,3-dihydro-1,2-benzoxazol-3-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-nitro-1,2-benzoxazol-3-one (CAS 36238-81-0) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 6-nitro-1,2-benzoxazol-3-one. InChIKey: CTXOGVILPOLLLD-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 6-nitro-1,2-benzoxazol-3-one |
| InChIKey | CTXOGVILPOLLLD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])ONC2=O |
Computed by PubChem (NCBI)