CAS 3889-13-2 appears in our catalog under these names: 5–Nitrobenzo(d)oxazol–2(3H)–one, 5-Nitrobenzo[d]oxazol-2(3H)-one, 95%, 5-Nitro-2,3-dihydro-1,3-benzoxazol-2-one 96%, 5-Nitro-2,3-dihydro-1,3-benzoxazol-2-one, 96%, 96%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 25g, 5g, 250mg, 10g, 100g, 1g.
5-nitro-3H-1,3-benzoxazol-2-one (CAS 3889-13-2) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 5-nitro-3H-1,3-benzoxazol-2-one. InChIKey: UTQPEXLRBRAERQ-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 5-nitro-3H-1,3-benzoxazol-2-one |
| InChIKey | UTQPEXLRBRAERQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=O)O2 |
Computed by PubChem (NCBI)