CAS 6086-24-4 appears in our catalog under these names: 5-Carboxy-2,1,3-benzoxadiazol-1-ium-1-olate, 95%, 5-Carboxy-2,1,3-benzoxadiazol-1-ium-1-olate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
1-oxido-2,1,3-benzoxadiazol-1-ium-5-carboxylic acid (CAS 6086-24-4) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 1-oxido-2,1,3-benzoxadiazol-1-ium-5-carboxylic acid. InChIKey: AXRCJZJVVZUOHN-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 1-oxido-2,1,3-benzoxadiazol-1-ium-5-carboxylic acid |
| InChIKey | AXRCJZJVVZUOHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=[N+](ON=C2C=C1C(=O)O)[O-] |
Computed by PubChem (NCBI)