CAS 81117-90-0 is the registry number for 7-Nitro-3H-1,3-benzoxazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
7-nitro-3H-1,3-benzoxazol-2-one (CAS 81117-90-0) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 7-nitro-3H-1,3-benzoxazol-2-one. InChIKey: SKYBXCYGTUEWBK-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 7-nitro-3H-1,3-benzoxazol-2-one |
| InChIKey | SKYBXCYGTUEWBK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])OC(=O)N2 |
Computed by PubChem (NCBI)