CAS 1250404-35-3 appears in our catalog under these names: 5-(Isoxazol-3-yl)oxazole-4-carboxylic Acid, 5-(1,2-Oxazol-3-yl)-1,3-oxazole-4-carboxylic acid. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 0,5g, 50mg.
5-(1,2-oxazol-3-yl)-1,3-oxazole-4-carboxylic acid (CAS 1250404-35-3) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 5-(1,2-oxazol-3-yl)-1,3-oxazole-4-carboxylic acid. InChIKey: MHJMDBBAEVYPIZ-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 5-(1,2-oxazol-3-yl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | MHJMDBBAEVYPIZ-UHFFFAOYSA-N |
| SMILES | C1=CON=C1C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)