CAS 1557678-19-9 is the registry number for 2,5-Dichloro-4-ethoxybenzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,5-dichloro-4-ethoxybenzoic acid (CAS 1557678-19-9) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 2,5-dichloro-4-ethoxybenzoic acid. InChIKey: KEUDLGXJFJJDSU-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2,5-dichloro-4-ethoxybenzoic acid |
| InChIKey | KEUDLGXJFJJDSU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)