Products 155820-63-6
CAS 155820-63-6 appears in our catalog under these names: benzyl 2-bromo-2,2-difluoroacetate, 95%, Benzyl 2-bromo-2,2-difluoroacetate, 95-<97%, Benzyl 2-bromo-2,2-difluoroacetate, Benzyl 2-bromo-2,2-difluoroacetate 95%, Benzyl 2-bromo-2,2-difluoroacetate, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g, 50g, 100g.
Benzyl 2-bromo-2,2-difluoroacetate (CAS 155820-63-6) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: benzyl 2-bromo-2,2-difluoroacetate. InChIKey: ZYBCQKXKMSMAAO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | benzyl 2-bromo-2,2-difluoroacetate |
| InChIKey | ZYBCQKXKMSMAAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(F)(F)Br |
Computed by PubChem (NCBI)