CAS 155983-20-3 appears in our catalog under these names: 2-Chloro-7-methoxyquinoline-3-carboxylic acid, 97%, 2-chloro-7-methoxyquinoline-3-carboxylic acid, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g.
2-chloro-7-methoxyquinoline-3-carboxylic acid (CAS 155983-20-3) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 2-chloro-7-methoxyquinoline-3-carboxylic acid. InChIKey: BTVKBYHEJQZDQT-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 2-chloro-7-methoxyquinoline-3-carboxylic acid |
| InChIKey | BTVKBYHEJQZDQT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC(=C(C=C2C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)