Products 157033-23-3
CAS 157033-23-3 appears in our catalog under these names: 2,5-Difluorophenylacetyl chloride 95%, (2,5-Difluoro-phenyl)-acetyl chloride, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2,5-difluorophenyl)acetyl chloride (CAS 157033-23-3) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 2-(2,5-difluorophenyl)acetyl chloride. InChIKey: LQGHDMOEOHWRGX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 2-(2,5-difluorophenyl)acetyl chloride |
| InChIKey | LQGHDMOEOHWRGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CC(=O)Cl)F |
Computed by PubChem (NCBI)