CAS 15854-75-8 is the registry number for 2-Methoxy-5-nitro-1,1'-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
1-methoxy-4-nitro-2-phenylbenzene (CAS 15854-75-8) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 1-methoxy-4-nitro-2-phenylbenzene. InChIKey: DFVBQSMLKLCRCB-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 1-methoxy-4-nitro-2-phenylbenzene |
| InChIKey | DFVBQSMLKLCRCB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])C2=CC=CC=C2 |
Computed by PubChem (NCBI)