CAS 1587-30-0 appears in our catalog under these names: Diethyl 2,3-dimethylfumarate, 98%, 98%, Diethyl 2,3-dimethylfumarate, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Diethyl (E)-2,3-dimethylbut-2-enedioate (CAS 1587-30-0) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: diethyl (E)-2,3-dimethylbut-2-enedioate. InChIKey: LLKGSLDFLYDTMI-BQYQJAHWSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | diethyl (E)-2,3-dimethylbut-2-enedioate |
| InChIKey | LLKGSLDFLYDTMI-BQYQJAHWSA-N |
| SMILES | CCOC(=O)/C(=C(\C)/C(=O)OCC)/C |
Computed by PubChem (NCBI)