Products 22644-89-9
CAS 22644-89-9 appears in our catalog under these names: (Z)-Diethyl 2,3-dimethylmaleate, 95%, (Z)–diethyl 2，3–dimethylmaleate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Diethyl (Z)-2,3-dimethylbut-2-enedioate (CAS 22644-89-9) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: diethyl (Z)-2,3-dimethylbut-2-enedioate. InChIKey: LLKGSLDFLYDTMI-FPLPWBNLSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | diethyl (Z)-2,3-dimethylbut-2-enedioate |
| InChIKey | LLKGSLDFLYDTMI-FPLPWBNLSA-N |
| SMILES | CCOC(=O)/C(=C(/C)\C(=O)OCC)/C |
Computed by PubChem (NCBI)