CAS 15872-28-3 appears in our catalog under these names: Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic Acid, 95%, 95%, Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid (CAS 15872-28-3) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid. InChIKey: NRIMHVFWRMABGJ-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid |
| InChIKey | NRIMHVFWRMABGJ-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C(=C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)