CAS 158800-60-3 is the registry number for Dimethyl (S)-2-phenylcyclopropane-1,1-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl (2S)-2-phenylcyclopropane-1,1-dicarboxylate (CAS 158800-60-3) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: dimethyl (2S)-2-phenylcyclopropane-1,1-dicarboxylate. InChIKey: HEDVHUQQVZUKBN-JTQLQIEISA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | dimethyl (2S)-2-phenylcyclopropane-1,1-dicarboxylate |
| InChIKey | HEDVHUQQVZUKBN-JTQLQIEISA-N |
| SMILES | COC(=O)C1(C[C@H]1C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)