CAS 7250-68-2 appears in our catalog under these names: Diethyl 4,4'-azodibenzoate, 95-<97%, Diethyl 4,4'-azodibenzoate, ≥97-<99%, Diethyl 4,4'–Azodibenzoate, Diethyl 4,4'-Azodibenzoate, 98%, 98%, Diethyl 4,4'-azodibenzoate, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Ambeed. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 200mg.
Ethyl 4-[(4-ethoxycarbonylphenyl)diazenyl]benzoate (CAS 7250-68-2) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: ethyl 4-[(4-ethoxycarbonylphenyl)diazenyl]benzoate. InChIKey: YFFNOBALALSBCH-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | ethyl 4-[(4-ethoxycarbonylphenyl)diazenyl]benzoate |
| InChIKey | YFFNOBALALSBCH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)OCC |
Computed by PubChem (NCBI)