CAS 158892-18-3 is the registry number for (R)-3-Amino-2,3-dihydrobenzo[b][1,4]oxazepin-4(5h)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3R)-3-amino-3,5-dihydro-2H-1,5-benzoxazepin-4-one (CAS 158892-18-3) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: (3R)-3-amino-3,5-dihydro-2H-1,5-benzoxazepin-4-one. InChIKey: ZHNDGCJXEHFSRM-ZCFIWIBFSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | (3R)-3-amino-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| InChIKey | ZHNDGCJXEHFSRM-ZCFIWIBFSA-N |
| SMILES | C1[C@H](C(=O)NC2=CC=CC=C2O1)N |
Computed by PubChem (NCBI)