CAS 199613-85-9 is the registry number for (S)-3-amino-2,3-dihydrobenzo(b)(1,4)oxazepin-4(5H)-one, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
(3S)-3-amino-3,5-dihydro-2H-1,5-benzoxazepin-4-one (CAS 199613-85-9) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: (3S)-3-amino-3,5-dihydro-2H-1,5-benzoxazepin-4-one. InChIKey: ZHNDGCJXEHFSRM-LURJTMIESA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | (3S)-3-amino-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| InChIKey | ZHNDGCJXEHFSRM-LURJTMIESA-N |
| SMILES | C1[C@@H](C(=O)NC2=CC=CC=C2O1)N |
Computed by PubChem (NCBI)