Products 15939-85-2
CAS 15939-85-2 appears in our catalog under these names: 2-((2-bromophenyl)sulfanyl)acetic acid, 2-Bromo-phenylthioacetic acid, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 100mg, 5g.
2-(2-bromophenyl)sulfanylacetic acid (CAS 15939-85-2) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: 2-(2-bromophenyl)sulfanylacetic acid. InChIKey: KQUNWFXSYMIICT-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO2S |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 2-(2-bromophenyl)sulfanylacetic acid |
| InChIKey | KQUNWFXSYMIICT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)SCC(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
2-[(2-Bromophenyl)sulfanyl]acetic acid, 2-((2-bromophenyl)sulfanyl)acetic acid, 2-Bromophenylthioacetic acid, 2-bromo-phenylthioacetic acid, 2-(2-bromophenyl)sulfanylacetic acid, Acetic acid, [(2-bromophenyl)thio]-, 2-[(2-Bromophenyl)thio]acetic Acid, 2-{(2-Bromophenyl)thio}acetic acid, Enamine_002695, (2-bromo-phenylsulfanyl)-acetic acid