Products 159427-17-5
CAS 159427-17-5 is the registry number for Ethyl 5-(2,4-dichlorophenyl)isoxazole-3-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Ethyl 5-(2,4-dichlorophenyl)-1,2-oxazole-3-carboxylate (CAS 159427-17-5) is a chemical compound with the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. IUPAC name: ethyl 5-(2,4-dichlorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: WAKCEBZISBIMLL-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO3 |
|---|---|
| Molecular weight | 286.11 g/mol |
| IUPAC name | ethyl 5-(2,4-dichlorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | WAKCEBZISBIMLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)