CAS 159694-58-3 is the registry number for Methyl 4-(4-hydroxybenzoyl)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g.
Methyl 4-(4-hydroxybenzoyl)benzoate (CAS 159694-58-3) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: methyl 4-(4-hydroxybenzoyl)benzoate. InChIKey: ZYVLQJHSCJEAAQ-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | methyl 4-(4-hydroxybenzoyl)benzoate |
| InChIKey | ZYVLQJHSCJEAAQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)