CAS 1604-14-4 appears in our catalog under these names: 2,6–Dichloro–isonicotinic acid ethyl ester, 2,6-Dichloro-isonicotinic acid ethyl ester, 95%, 95%, 2,6-Dichloro-isonicotinic acid ethyl ester, 97%, 2,6-Dichloro-isonicotinic acid ethyl ester, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 500g.
Ethyl 2,6-dichloropyridine-4-carboxylate (CAS 1604-14-4) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 2,6-dichloropyridine-4-carboxylate. InChIKey: PVPBMYSZXFNZOM-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 2,6-dichloropyridine-4-carboxylate |
| InChIKey | PVPBMYSZXFNZOM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1)Cl)Cl |
Computed by PubChem (NCBI)