CAS 16046-01-8 is the registry number for H–Gly–Pro–βNA. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
Glycyl-L-proline 2-naphthylamide is an N-(2-naphthyl)carboxamide obtained by formal condensation of the carboxy group of glycyl-L-proline with the amino group of 2-naphthylamine. It has a role as a chromogenic compound. It is a dipeptide and a N-(2-naphthyl)carboxamide.
Source: ChEBI
| Molecular formula | C17H19N3O2 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | (2S)-1-(2-aminoacetyl)-N-naphthalen-2-ylpyrrolidine-2-carboxamide |
| InChIKey | WKQUUNDBFODDFP-HNNXBMFYSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CN)C(=O)NC2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)