Products 16081-71-3
CAS 16081-71-3 appears in our catalog under these names: 7-Bromo-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid, 7-Bromo-2，3-dihydrobenzo[b][1，4]dioxine-5-carboxylic acid, 95%, 7-Bromo-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg.
7-bromo-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (CAS 16081-71-3) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 7-bromo-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid. InChIKey: GDFMTYVYQCKKOE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 7-bromo-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
| InChIKey | GDFMTYVYQCKKOE-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2O1)Br)C(=O)O |
Computed by PubChem (NCBI)