Products 160911-12-6
CAS 160911-12-6 is the registry number for NCR 631, 97.36%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 50 mg, 10 mg.
2-amino-4,6-dibromo-3-hydroxybenzoic acid (CAS 160911-12-6) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: 2-amino-4,6-dibromo-3-hydroxybenzoic acid. InChIKey: SEAVVBUQSYHVKP-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | 2-amino-4,6-dibromo-3-hydroxybenzoic acid |
| InChIKey | SEAVVBUQSYHVKP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)O)N)C(=O)O)Br |
Computed by PubChem (NCBI)