Products 161125-35-5

CAS 161125-35-5 is the registry number for 2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-hydroxybutanoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g, 100g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybutanoic acid (CAS 161125-35-5) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybutanoic acid. InChIKey: YFCXLWRCVZSPCF-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19NO5
Molecular weight341.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybutanoic acid
InChIKeyYFCXLWRCVZSPCF-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCO)C(=O)O

Computed by PubChem (NCBI)